EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29N3O4S2 |
| Net Charge | 0 |
| Average Mass | 427.592 |
| Monoisotopic Mass | 427.15995 |
| SMILES | CSCC[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)CCSC)C(=O)O |
| InChI | InChI=1S/C19H29N3O4S2/c1-27-10-8-14(20)17(23)22-16(12-13-6-4-3-5-7-13)18(24)21-15(19(25)26)9-11-28-2/h3-7,14-16H,8-12,20H2,1-2H3,(H,21,24)(H,22,23)(H,25,26)/t14-,15-,16-/m0/s1 |
| InChIKey | ZACMJPCWVSLCNS-JYJNAYRXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Met-Phe-Met (CHEBI:160990) has functional parent L-methionine (CHEBI:16643) |
| Met-Phe-Met (CHEBI:160990) has functional parent L-phenylalanine (CHEBI:17295) |
| Met-Phe-Met (CHEBI:160990) is a tripeptide (CHEBI:47923) |
| Met-Phe-Met (CHEBI:160990) is tautomer of Met-Phe-Met zwitterion (CHEBI:191211) |
| Incoming Relation(s) |
| Met-Phe-Met zwitterion (CHEBI:191211) is tautomer of Met-Phe-Met (CHEBI:160990) |
| IUPAC Name |
|---|
| L-methionyl-L-phenylalanyl-L-methionine |
| Synonyms | Source |
|---|---|
| (2S)-2-[[(2S)-2-[[(2S)-2-amino-4-methylsulanylbutanoyl]amino]-3-phenylpropanoyl]amino]-4-methylsulanylbutanoic acid | SUBMITTER |
| H-Met-Phe-Met-OH | ChEBI |
| H-L-Met-L-Phe-L-Met-OH | ChEBI |
| methionylphenylalanyl-methionine | ChEBI |
| M-F-M | ChEBI |
| MFM | ChEBI |