EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H28O |
| Net Charge | 0 |
| Average Mass | 284.443 |
| Monoisotopic Mass | 284.21402 |
| SMILES | CC1=C(/C=C/C(C)=C/C=C\C(C)=C\C=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H28O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15H,7,10,14H2,1-5H3/b9-6-,12-11+,16-8+,17-13+ |
| InChIKey | NCYCYZXNIZJOKI-IOUUIBBYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | chromophore The part (atom or group of atoms) of a molecular entity in which the electronic transition responsible for a given spectral band is approximately localized. |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-cis-retinal (CHEBI:16066) has role chromophore (CHEBI:23240) |
| 11-cis-retinal (CHEBI:16066) has role human metabolite (CHEBI:77746) |
| 11-cis-retinal (CHEBI:16066) has role mouse metabolite (CHEBI:75771) |
| 11-cis-retinal (CHEBI:16066) is a retinal (CHEBI:15035) |
| Incoming Relation(s) |
| (3R)-11-cis-3-hydroxyretinal (CHEBI:66898) has functional parent 11-cis-retinal (CHEBI:16066) |
| (3S)-11-cis-3-hydroxyretinal (CHEBI:52227) has functional parent 11-cis-retinal (CHEBI:16066) |
| IUPAC Name |
|---|
| 11-cis-retinal |
| Synonyms | Source |
|---|---|
| 11-cis-retinal | ChEBI |
| 11-cis-Retinal | KEGG COMPOUND |
| 11-cis-retinene | ChEBI |
| 11-cis-Retinene | KEGG COMPOUND |
| 11-cis-vitamin A aldehyde | ChEBI |
| 11-cis-Vitamin A aldehyde | KEGG COMPOUND |
| UniProt Name | Source |
|---|---|
| 11-cis-retinal | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C02110 | KEGG COMPOUND |
| CPD-881 | MetaCyc |
| HMDB0002152 | HMDB |
| LMPR01090003 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1914181 | Reaxys |
| CAS:564-87-4 | HMDB |
| Citations |
|---|