EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16003 - (R)-3-(4-hydroxyphenyl)lactic acid
| Formula | C9H10O4 |
| Net Charge | 0 |
| Average Mass | 182.175 |
| Monoisotopic Mass | 182.05791 |
| SMILES | O=C(O)[C@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C9H10O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8,10-11H,5H2,(H,12,13)/t8-/m1/s1 |
| InChIKey | JVGVDSSUAVXRDY-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) is a 3-(4-hydroxyphenyl)lactic acid (CHEBI:17385) |
| (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) is conjugate acid of (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) |
| Incoming Relation(s) |
| (R)-3-(4-hydroxyphenyl)lactate (CHEBI:10980) is conjugate base of (R)-3-(4-hydroxyphenyl)lactic acid (CHEBI:16003) |
| IUPAC Name |
|---|
| (2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoic acid |