EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H2O4 |
| Net Charge | -2 |
| Average Mass | 102.045 |
| Monoisotopic Mass | 101.99641 |
| SMILES | O=C([O-])CC(=O)[O-] |
| InChI | InChI=1S/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/p-2 |
| InChIKey | OFOBLEOULBTSOW-UHFFFAOYSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (23111923) |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| malonate(2−) (CHEBI:15792) has role human metabolite (CHEBI:77746) |
| malonate(2−) (CHEBI:15792) has role mitochondrial respiratory-chain inhibitor (CHEBI:25355) |
| malonate(2−) (CHEBI:15792) is a saturated dicarboxylic acid dianion(2−) (CHEBI:133291) |
| malonate(2−) (CHEBI:15792) is conjugate base of malonate(1−) (CHEBI:30795) |
| Incoming Relation(s) |
| hydroxymalonate(2−) (CHEBI:17649) has functional parent malonate(2−) (CHEBI:15792) |
| methylmalonate(2−) (CHEBI:17453) has functional parent malonate(2−) (CHEBI:15792) |
| oxomalonate(2−) (CHEBI:17121) has functional parent malonate(2−) (CHEBI:15792) |
| sodium malonate (CHEBI:62983) has part malonate(2−) (CHEBI:15792) |
| malonate(1−) (CHEBI:30795) is conjugate acid of malonate(2−) (CHEBI:15792) |
| IUPAC Name |
|---|
| propanedioate |
| Synonyms | Source |
|---|---|
| malo | IUPAC |
| MALONATE ION | PDBeChem |
| malonic acid, ion(2−) | ChemIDplus |
| propanedioic acid, ion(2−) | ChemIDplus |
| −OOC‒CH2‒COO− | ChEBI |
| UniProt Name | Source |
|---|---|
| malonate | UniProt |