EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12N2O3S |
| Net Charge | 0 |
| Average Mass | 192.240 |
| Monoisotopic Mass | 192.05686 |
| SMILES | C[C@H](N)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H12N2O3S/c1-3(7)5(9)8-4(2-12)6(10)11/h3-4,12H,2,7H2,1H3,(H,8,9)(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | JQDFGZKKXBEANU-IMJSIDKUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Cys (CHEBI:157787) has functional parent L-alanine (CHEBI:16977) |
| Ala-Cys (CHEBI:157787) has functional parent L-cysteine (CHEBI:17561) |
| Ala-Cys (CHEBI:157787) is a dipeptide (CHEBI:46761) |
| Ala-Cys (CHEBI:157787) is tautomer of Ala-Cys zwitterion (CHEBI:169958) |
| Incoming Relation(s) |
| Ala-Cys zwitterion (CHEBI:169958) is tautomer of Ala-Cys (CHEBI:157787) |
| IUPAC Name |
|---|
| L-alanyl-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-2-[[(2S)-2-aminopropanoyl]amino]-3-sulfanylpropanoic acid | IUPAC |
| A-C | ChEBI |
| AC | ChEBI |
| A-C dipeptide | ChEBI |
| AC dipeptide | ChEBI |
| alanylcysteine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8233955 | ChemSpider |
| HMDB0028684 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:2490-72-4 | HMDB |
| Citations |
|---|