EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O4 |
| Net Charge | 0 |
| Average Mass | 304.346 |
| Monoisotopic Mass | 304.14231 |
| SMILES | [H]C(C)=C1CN2C(=O)c3cc(OC)c(O)cc3N[C@H](OC)[C@]2([H])C1 |
| InChI | InChI=1S/C16H20N2O4/c1-4-9-5-12-15(22-3)17-11-7-13(19)14(21-2)6-10(11)16(20)18(12)8-9/h4,6-7,12,15,17,19H,5,8H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | UQVNRKBFAXNOGA-SWLSCSKDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces achromogenes (ncbitaxon:67255) | - | PubMed (19270147) |
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tomaymycin (CHEBI:157681) has role alkylating agent (CHEBI:22333) |
| tomaymycin (CHEBI:157681) has role antibacterial agent (CHEBI:33282) |
| tomaymycin (CHEBI:157681) has role antineoplastic agent (CHEBI:35610) |
| tomaymycin (CHEBI:157681) has role bacterial metabolite (CHEBI:76969) |
| tomaymycin (CHEBI:157681) is a aromatic ether (CHEBI:35618) |
| tomaymycin (CHEBI:157681) is a olefinic compound (CHEBI:78840) |
| tomaymycin (CHEBI:157681) is a phenols (CHEBI:33853) |
| tomaymycin (CHEBI:157681) is a pyrrolobenzodiazepine (CHEBI:131437) |
| Incoming Relation(s) |
| (E)-tomaymycin (CHEBI:167317) is a tomaymycin (CHEBI:157681) |
| (Z)-tomaymycin (CHEBI:167318) is a tomaymycin (CHEBI:157681) |
| IUPAC Name |
|---|
| (11R,11aS)-2-ethylidene-8-hydroxy-7,11-dimethoxy-1,2,3,10,11,11a-hexahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one |
| Manual Xrefs | Databases |
|---|---|
| C00018843 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:35050-55-6 | ChemIDplus |
| Citations |
|---|