EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O7 |
| Net Charge | -1 |
| Average Mass | 193.131 |
| Monoisotopic Mass | 193.03538 |
| SMILES | O=C([O-])[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)4(5(10)11)13-6(12)3(1)9/h1-4,6-9,12H,(H,10,11)/p-1/t1-,2-,3-,4-,6-/m0/s1 |
| InChIKey | AEMOLEFTQBMNLQ-BYHBOUFCSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-mannopyranuronate (CHEBI:157625) is a carbohydrate acid anion (CHEBI:33721) |
| α-D-mannopyranuronate (CHEBI:157625) is a monocarboxylic acid anion (CHEBI:35757) |
| α-D-mannopyranuronate (CHEBI:157625) is conjugate base of α-D-mannopyranuronic acid (CHEBI:16224) |
| Incoming Relation(s) |
| α-D-mannopyranuronic acid (CHEBI:16224) is conjugate acid of α-D-mannopyranuronate (CHEBI:157625) |
| UniProt Name | Source |
|---|---|
| α-D-mannuronate | UniProt |