EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N7O5.4H2O |
| Net Charge | 0 |
| Average Mass | 477.475 |
| Monoisotopic Mass | 477.21833 |
| SMILES | CN1C(=O)C[C@@H](C(=O)N[C@@H](Cc2cncn2)C(=O)N2CCC[C@H]2C(N)=O)NC1=O.O.O.O.O |
| InChI | InChI=1S/C17H23N7O5.4H2O/c1-23-13(25)6-10(22-17(23)29)15(27)21-11(5-9-7-19-8-20-9)16(28)24-4-2-3-12(24)14(18)26;;;;/h7-8,10-12H,2-6H2,1H3,(H2,18,26)(H,19,20)(H,21,27)(H,22,29);4*1H2/t10-,11-,12-;;;;/m0..../s1 |
| InChIKey | HRCJDWMUKPHPHR-NTFWNTCYSA-N |
| Roles Classification |
|---|
| Application: | central nervous system drug A class of drugs producing both physiological and psychological effects through a variety of mechanisms involving the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taltirelin tetrahydrate (CHEBI:157598) has part taltirelin (CHEBI:135653) |
| taltirelin tetrahydrate (CHEBI:157598) has role central nervous system drug (CHEBI:35470) |
| taltirelin tetrahydrate (CHEBI:157598) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| N-{[(4S)-1-methyl-2,6-dioxohexahydropyrimidin-4-yl]carbonyl}-L-histidyl-L-prolinamide—water (1/4) |
| Synonyms | Source |
|---|---|
| N-{[(4S)-1-methyl-2,6-dioxohexahydropyrimidin-4-yl]carbonyl}-L-histidyl-L-prolinamide tetrahydrate | IUPAC |
| (−)-N-[(S)-hexahydro-1-methyl- 2,6-dioxo-4-pyrimidinyl-carbonyl]-L-histidyl-L-prolinamide tetrahydrate | ChEBI |
| taltirelin hydrate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Ceredist | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:201677-75-0 | ChemIDplus |
| Citations |
|---|