EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N7O5 |
| Net Charge | 0 |
| Average Mass | 405.415 |
| Monoisotopic Mass | 405.17607 |
| SMILES | CN1C(=O)C[C@@H](C(=O)N[C@@H](Cc2cncn2)C(=O)N2CCC[C@H]2C(N)=O)NC1=O |
| InChI | InChI=1S/C17H23N7O5/c1-23-13(25)6-10(22-17(23)29)15(27)21-11(5-9-7-19-8-20-9)16(28)24-4-2-3-12(24)14(18)26/h7-8,10-12H,2-6H2,1H3,(H2,18,26)(H,19,20)(H,21,27)(H,22,29)/t10-,11-,12-/m0/s1 |
| InChIKey | LQZAIAZUDWIVPM-SRVKXCTJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. |
| Applications: | analgesic An agent capable of relieving pain without the loss of consciousness or without producing anaesthesia. In addition, analgesic is a role played by a compound which is exhibited by a capability to cause a reduction of pain symptoms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nootropic agent Any compound that improves mental functions such as cognition, memory, intelligence, motivation, attention, and concentration. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taltirelin (CHEBI:135653) has role analgesic (CHEBI:35480) |
| taltirelin (CHEBI:135653) has role neuroprotective agent (CHEBI:63726) |
| taltirelin (CHEBI:135653) has role nootropic agent (CHEBI:66980) |
| taltirelin (CHEBI:135653) is a oligopeptide (CHEBI:25676) |
| Incoming Relation(s) |
| taltirelin tetrahydrate (CHEBI:157598) has part taltirelin (CHEBI:135653) |
| IUPAC Name |
|---|
| N-{[(4S)-1-methyl-2,6-dioxohexahydropyrimidin-4-yl]carbonyl}-L-histidyl-L-prolinamide |
| INNs | Source |
|---|---|
| taltirelinum | WHO MedNet |
| taltiréline | WHO MedNet |
| taltirelin | WHO MedNet |
| taltirelina | WHO MedNet |
| Synonyms | Source |
|---|---|
| TA 0910 | DrugCentral |
| TA-0910 | DrugCentral |
| 1-methyl-(S)-4,5-dihydroorotyl-L-histidyl-L-prolinamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 2560 | DrugCentral |
| Taltirelin | Wikipedia |
| 102734 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:103300-74-9 | ChemIDplus |
| Citations |
|---|