EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | [H]C(=O)[C@@H](N)CCC(=O)O |
| InChI | InChI=1S/C5H9NO3/c6-4(3-7)1-2-5(8)9/h3-4H,1-2,6H2,(H,8,9)/t4-/m0/s1 |
| InChIKey | MPUUQNGXJSEWTF-BYPYZUCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) has functional parent valeric acid (CHEBI:17418) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) has role Escherichia coli metabolite (CHEBI:76971) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is a 5-oxo monocarboxylic acid (CHEBI:35952) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is a glutamic semialdehyde (CHEBI:24313) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is a γ-amino acid (CHEBI:33707) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is conjugate acid of (S)-4-amino-5-oxopentanoate (CHEBI:11022) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is tautomer of (S)-4-amino-5-oxopentanoic acid zwitterion (CHEBI:57501) |
| Incoming Relation(s) |
| (S)-4-amino-5-oxopentanoate (CHEBI:11022) is conjugate base of (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) |
| (S)-4-amino-5-oxopentanoic acid zwitterion (CHEBI:57501) is tautomer of (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) |
| IUPAC Name |
|---|
| (4S)-4-amino-5-oxopentanoic acid |
| Synonyms | Source |
|---|---|
| 4-AMINO-5-OXO-PENTANOIC ACID | PDBeChem |
| glutamate-1-semialdehyde | ChemIDplus |
| (S)-4-amino-5-oxopentanoic acid | ChemIDplus |
| L-Glutamate 1-semialdehyde | KEGG COMPOUND |
| (S)-4-Amino-5-oxopentanoate | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:68462-55-5 | ChemIDplus |