EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8NO3 |
| Net Charge | -1 |
| Average Mass | 130.123 |
| Monoisotopic Mass | 130.05097 |
| SMILES | [H]C(=O)[C@@H](N)CCC(=O)[O-] |
| InChI | InChI=1S/C5H9NO3/c6-4(3-7)1-2-5(8)9/h3-4H,1-2,6H2,(H,8,9)/p-1/t4-/m0/s1 |
| InChIKey | MPUUQNGXJSEWTF-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-4-amino-5-oxopentanoate (CHEBI:11022) has functional parent valerate (CHEBI:31011) |
| (S)-4-amino-5-oxopentanoate (CHEBI:11022) is a monocarboxylic acid anion (CHEBI:35757) |
| (S)-4-amino-5-oxopentanoate (CHEBI:11022) is a γ-amino acid anion (CHEBI:71666) |
| (S)-4-amino-5-oxopentanoate (CHEBI:11022) is conjugate base of (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) |
| Incoming Relation(s) |
| (S)-4-amino-5-oxopentanoic acid (CHEBI:15757) is conjugate acid of (S)-4-amino-5-oxopentanoate (CHEBI:11022) |
| IUPAC Name |
|---|
| (4S)-4-amino-5-oxopentanoate |