EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12O8P2 |
| Net Charge | 0 |
| Average Mass | 262.091 |
| Monoisotopic Mass | 262.00074 |
| SMILES | C/C(=C\COP(=O)(O)OP(=O)(O)O)CO |
| InChI | InChI=1S/C5H12O8P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h2,6H,3-4H2,1H3,(H,10,11)(H2,7,8,9)/b5-2+ |
| InChIKey | MDSIZRKJVDMQOQ-GORDUTHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) has role Escherichia coli metabolite (CHEBI:76971) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) has role epitope (CHEBI:53000) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) has role phosphoantigen (CHEBI:59544) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) is a prenol phosphate (CHEBI:26250) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) is conjugate acid of (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) |
| Incoming Relation(s) |
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) is conjugate base of (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) |
| IUPAC Name |
|---|
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-2-methyl-2-butenyl 4-diphosphate | KEGG COMPOUND |
| 1-hydroxy-2-methylbut-2(E)-en-4-yl diphosphate | ChEBI |
| 1-hydroxy-2-methylbut-2(E)-en-4-yl pyrophosphate | ChEBI |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl pyrophosphate | ChEBI |
| (E)-4-Hydroxy-3-methylbut-2-en-1-yl diphosphate | KEGG COMPOUND |
| (E)-4-Hydroxy-3-methyl-but-2-enyl diphosphate | KEGG COMPOUND |
| Citations |
|---|