EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9O8P2 |
| Net Charge | -3 |
| Average Mass | 259.067 |
| Monoisotopic Mass | 258.97891 |
| SMILES | C/C(=C\COP(=O)([O-])OP(=O)([O-])[O-])CO |
| InChI | InChI=1S/C5H12O8P2/c1-5(4-6)2-3-12-15(10,11)13-14(7,8)9/h2,6H,3-4H2,1H3,(H,10,11)(H2,7,8,9)/p-3/b5-2+ |
| InChIKey | MDSIZRKJVDMQOQ-GORDUTHDSA-K |
| Roles Classification |
|---|
| Biological Roles: | phosphoantigen Any antigen that is a phosphorylated microbial metabolite which activates an immune response in humans. epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) has role epitope (CHEBI:53000) |
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) has role phosphoantigen (CHEBI:59544) |
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) is a organophosphate oxoanion (CHEBI:58945) |
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) is conjugate base of (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) |
| Incoming Relation(s) |
| (2E)-4-hydroxy-3-methylbut-2-en-1-yl diphosphate (CHEBI:15664) is conjugate acid of (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate(3−) (CHEBI:128753) |
| IUPAC Name |
|---|
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate |
| Synonyms | Source |
|---|---|
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate trianion | ChEBI |
| (2E)-4-hydroxy-3-methylbut-2-enyl pyrophosphate(3−) | ChEBI |
| (E)-4-hydroxy-3-methyl-but-2-enyl pyrophosphate | ChEBI |
| HMBPP | ChEBI |
| UniProt Name | Source |
|---|---|
| (2E)-4-hydroxy-3-methylbut-2-enyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9274408 | Reaxys |
| Citations |
|---|