EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2H4N.O6S2 |
| Net Charge | 0 |
| Average Mass | 196.206 |
| Monoisotopic Mass | 195.98238 |
| SMILES | O=S([O-])OOS(=O)[O-].[NH4+].[NH4+] |
| InChI | InChI=1S/2H3N.H2O6S2/c;;1-7(2)5-6-8(3)4/h2*1H3;(H,1,2)(H,3,4) |
| InChIKey | VAZSKTXWXKYQJF-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ammonium persulfate (CHEBI:156543) has part peroxydisulfate (CHEBI:29267) |
| ammonium persulfate (CHEBI:156543) has role allergen (CHEBI:50904) |
| ammonium persulfate (CHEBI:156543) has role oxidising agent (CHEBI:63248) |
| ammonium persulfate (CHEBI:156543) is a inorganic ammonium salt (CHEBI:147406) |
| IUPAC Name |
|---|
| diammonium [(sulfonatoperoxy)sulfonyl]oxidanide |
| Synonyms | Source |
|---|---|
| Ammonium peroxydisulfate | ChemIDplus |
| APS | ChEBI |
| Diammonium peroxydisulfate | ChemIDplus |
| Diammonium persulfate | ChemIDplus |
| Peroxydisulfuric acid, diammonium salt | ChemIDplus |
| Persulfate d'ammonium | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Ammonium_persulfate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:7727-54-0 | ChemIDplus |
| Citations |
|---|