EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6N2O2S2 |
| Net Charge | 0 |
| Average Mass | 214.271 |
| Monoisotopic Mass | 213.98707 |
| SMILES | CC(=O)Nc1c2sscc-2nc1=O |
| InChI | InChI=1S/C7H6N2O2S2/c1-3(10)8-5-6-4(2-12-13-6)9-7(5)11/h2H,1H3,(H,8,10)(H,9,11) |
| InChIKey | HBUNPJGMNVQSBX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photobacterium halotolerans (ncbitaxon:265726) | - | PubMed (21339958) | Strain: S2753 |
| Saccharothrix algeriensis (ncbitaxon:173560) | - | PubMed (32642829) | Strain: NRRL B-24137 |
| Streptomyces clavuligerus (ncbitaxon:1901) | |||
| - | PubMed (468729) | ||
| - | PubMed (21041678) | ||
| Streptomyces flavogriseus (ncbitaxon:67299) | - | PubMed (28740758) | Strain: NJ-4 |
| Streptomyces sp. (ncbitaxon:1931) | - | PubMed (28627048) | Strain: DT-A37 |
| Yersinia ruckeri ATCC 29473 (ncbitaxon:527005) | - | PubMed (23572522) |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| holomycin (CHEBI:156451) has role antibacterial agent (CHEBI:33282) |
| holomycin (CHEBI:156451) has role antineoplastic agent (CHEBI:35610) |
| holomycin (CHEBI:156451) has role bacterial metabolite (CHEBI:76969) |
| holomycin (CHEBI:156451) has role chelator (CHEBI:38161) |
| holomycin (CHEBI:156451) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| holomycin (CHEBI:156451) has role marine metabolite (CHEBI:76507) |
| holomycin (CHEBI:156451) is a acetamides (CHEBI:22160) |
| holomycin (CHEBI:156451) is a dithiolopyrrolone antibiotic (CHEBI:156449) |
| Incoming Relation(s) |
| thiolutin (CHEBI:156450) has functional parent holomycin (CHEBI:156451) |
| IUPAC Name |
|---|
| N-(5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)acetamide |
| Synonyms | Source |
|---|---|
| 6-acetamido-1,2-dithiolo[4,3-b]pyrrol-5(4H)-one | ChemIDplus |
| 6-(acetylamino)-1,2-dithiolo[4,3-b]pyrrol-5(4H)-one | ChEBI |
| N-(4,5-dihydro-5-oxo-1,2-dithiolo-[4,3-b]pyrrol-6-yl)acetamide | ChemIDplus |
| N-{5-oxo-4H,5H-[1,2]dithiolo[4,3-b]pyrrol-6-yl}acetamide | IUPAC |
| N-(5-oxo-4H-dithiolo[4,3-b]pyrrol-6-yl)acetamide | ChEBI |
| N-demethylthiolutin | ChemIDplus |
| Citations |
|---|