EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156450 - thiolutin
| Formula | C8H8N2O2S2 |
| Net Charge | 0 |
| Average Mass | 228.298 |
| Monoisotopic Mass | 228.00272 |
| SMILES | CC(=O)Nc1c2sscc-2n(C)c1=O |
| InChI | InChI=1S/C8H8N2O2S2/c1-4(11)9-6-7-5(3-13-14-7)10(2)8(6)12/h3H,1-2H3,(H,9,11) |
| InChIKey | MHMRAFONCSQAIA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces kasugaensis (ncbitaxon:1946) | - | PubMed (2262169) | Strain: IFO 13851 |
| Saccharothrix algeriensis (ncbitaxon:173560) | - | PubMed (24723205) | Strain: NRRL B-24137 |
| Roles Classification |
|---|
| Chemical Role: | chelator A ligand with two or more separate binding sites that can bind to a single metallic central atom, forming a chelate. |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiolutin (CHEBI:156450) has functional parent holomycin (CHEBI:156451) |
| thiolutin (CHEBI:156450) has role angiogenesis inhibitor (CHEBI:48422) |
| thiolutin (CHEBI:156450) has role antibacterial agent (CHEBI:33282) |
| thiolutin (CHEBI:156450) has role antifungal agent (CHEBI:35718) |
| thiolutin (CHEBI:156450) has role antineoplastic agent (CHEBI:35610) |
| thiolutin (CHEBI:156450) has role bacterial metabolite (CHEBI:76969) |
| thiolutin (CHEBI:156450) has role chelator (CHEBI:38161) |
| thiolutin (CHEBI:156450) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| thiolutin (CHEBI:156450) has role marine metabolite (CHEBI:76507) |
| thiolutin (CHEBI:156450) has role protein synthesis inhibitor (CHEBI:48001) |
| thiolutin (CHEBI:156450) has role toxin (CHEBI:27026) |
| thiolutin (CHEBI:156450) is a acetamides (CHEBI:22160) |
| thiolutin (CHEBI:156450) is a dithiolopyrrolone antibiotic (CHEBI:156449) |
| IUPAC Name |
|---|
| N-(4-methyl-5-oxo-4,5-dihydro[1,2]dithiolo[4,3-b]pyrrol-6-yl)acetamide |
| Synonyms | Source |
|---|---|
| N-(4-methyl-5-oxodithiolo[4,3-b]pyrrol-6-yl)acetamide | ChEBI |
| acetopyrrothine | ChemIDplus |
| acetopyrrothin | ChemIDplus |
| N-(4,5-dihydro-4-methyl-5-oxo-1,2-dithiolo[4,3-b]pyrrol-6-yl)acetamide | ChemIDplus |
| 6-acetamido-4-methyl-1,2-dithiolo[4,3-b]pyrrol-5(4H)-one | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Thiolutin | Wikipedia |
| FDB012539 | FooDB |
| CPD-17934 | MetaCyc |
| HMDB0034228 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:209485 | Reaxys |
| CAS:87-11-6 | ChemIDplus |
| Citations |
|---|