EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | CC1=CC(=O)[C@]2(O[C@H]2C(=O)CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C12H15NO4/c1-6(2)4-8(14)10-12(17-10)9(15)5-7(3)13-11(12)16/h5-6,10H,4H2,1-3H3,(H,13,16)/t10-,12+/m0/s1 |
| InChIKey | DWCXXICTUDDKTB-CMPLNLGQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus flavipes (ncbitaxon:41900) | - | DOI (10.1039/P19720002071) | |
| Cladobotryum rubrobrunnescens (ncbitaxon:100994) | - | DOI (10.1515/znc-1995-5-605) | |
| Macrophoma (ncbitaxon:108329) | - | DOI (10.1080/00021369.1983.10865794) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. mycotoxin Poisonous substance produced by fungi. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-flavipucine (CHEBI:156437) has part epoxy group (CHEBI:30721) |
| (−)-flavipucine (CHEBI:156437) has part isobutyl group (CHEBI:30356) |
| (−)-flavipucine (CHEBI:156437) has part δ-lactam ring (CHEBI:52910) |
| (−)-flavipucine (CHEBI:156437) has role Aspergillus metabolite (CHEBI:76956) |
| (−)-flavipucine (CHEBI:156437) has role antibacterial agent (CHEBI:33282) |
| (−)-flavipucine (CHEBI:156437) has role antifungal agent (CHEBI:35718) |
| (−)-flavipucine (CHEBI:156437) has role antineoplastic agent (CHEBI:35610) |
| (−)-flavipucine (CHEBI:156437) has role mycotoxin (CHEBI:25442) |
| (−)-flavipucine (CHEBI:156437) is a spiro-epoxide (CHEBI:133131) |
| (−)-flavipucine (CHEBI:156437) is a triketone (CHEBI:140322) |
| (−)-flavipucine (CHEBI:156437) is a δ-lactam (CHEBI:77727) |
| (−)-flavipucine (CHEBI:156437) is enantiomer of (+)-flavipucine (CHEBI:156436) |
| Incoming Relation(s) |
| (+)-flavipucine (CHEBI:156436) is enantiomer of (−)-flavipucine (CHEBI:156437) |
| IUPAC Name |
|---|
| (2S,3S)-6-methyl-2-(3-methylbutanoyl)-1-oxa-7-azaspiro[2.5]oct-5-ene-4,8-dione |
| Citations |
|---|