EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15NO4 |
| Net Charge | 0 |
| Average Mass | 237.255 |
| Monoisotopic Mass | 237.10011 |
| SMILES | CC1=CC(=O)[C@@]2(O[C@@H]2C(=O)CC(C)C)C(=O)N1 |
| InChI | InChI=1S/C12H15NO4/c1-6(2)4-8(14)10-12(17-10)9(15)5-7(3)13-11(12)16/h5-6,10H,4H2,1-3H3,(H,13,16)/t10-,12+/m1/s1 |
| InChIKey | DWCXXICTUDDKTB-PWSUYJOCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladobotryum rubrobrunnescens (ncbitaxon:100994) | - | DOI (10.1515/znc-1995-5-605) | |
| Phoma sp. (ncbitaxon:1707701) | - | PubMed (27376480) |
| Roles Classification |
|---|
| Biological Roles: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. mycotoxin Poisonous substance produced by fungi. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-flavipucine (CHEBI:156436) has part epoxy group (CHEBI:30721) |
| (+)-flavipucine (CHEBI:156436) has part isobutyl group (CHEBI:30356) |
| (+)-flavipucine (CHEBI:156436) has part δ-lactam ring (CHEBI:52910) |
| (+)-flavipucine (CHEBI:156436) has role Aspergillus metabolite (CHEBI:76956) |
| (+)-flavipucine (CHEBI:156436) has role antibacterial agent (CHEBI:33282) |
| (+)-flavipucine (CHEBI:156436) has role antifungal agent (CHEBI:35718) |
| (+)-flavipucine (CHEBI:156436) has role antineoplastic agent (CHEBI:35610) |
| (+)-flavipucine (CHEBI:156436) has role mycotoxin (CHEBI:25442) |
| (+)-flavipucine (CHEBI:156436) is a spiro-epoxide (CHEBI:133131) |
| (+)-flavipucine (CHEBI:156436) is a triketone (CHEBI:140322) |
| (+)-flavipucine (CHEBI:156436) is a δ-lactam (CHEBI:77727) |
| (+)-flavipucine (CHEBI:156436) is enantiomer of (−)-flavipucine (CHEBI:156437) |
| Incoming Relation(s) |
| (−)-flavipucine (CHEBI:156437) is enantiomer of (+)-flavipucine (CHEBI:156436) |
| IUPAC Name |
|---|
| (2R,3R)-6-methyl-2-(3-methylbutanoyl)-1-oxa-7-azaspiro[2.5]oct-5-ene-4,8-dione |
| Citations |
|---|