EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26O5 |
| Net Charge | 0 |
| Average Mass | 382.456 |
| Monoisotopic Mass | 382.17802 |
| SMILES | C/C=C/C1=CC2=CC3=C(C(=O)CCCCCCC)C(=O)O[C@@]3(C)C(=O)C2=CO1 |
| InChI | InChI=1S/C23H26O5/c1-4-6-7-8-9-11-19(24)20-18-13-15-12-16(10-5-2)27-14-17(15)21(25)23(18,3)28-22(20)26/h5,10,12-14H,4,6-9,11H2,1-3H3/b10-5+/t23-/m1/s1 |
| InChIKey | IIPVSGPTPPURBD-HAOIVFDCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monascus pilosus (ncbitaxon:89488) | - | PubMed (23504076) | |
| Monascus purpureus (ncbitaxon:5098) | - | PubMed (21506577) | Strain: NTU 568 |
| Talaromyces marneffei (ncbitaxon:37727) | - | PubMed (25335861) |
| Roles Classification |
|---|
| Chemical Role: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). |
| Biological Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monascorubrin (CHEBI:156408) has role anti-inflammatory agent (CHEBI:67079) |
| monascorubrin (CHEBI:156408) has role antineoplastic agent (CHEBI:35610) |
| monascorubrin (CHEBI:156408) has role biological pigment (CHEBI:26130) |
| monascorubrin (CHEBI:156408) has role food colouring (CHEBI:77182) |
| monascorubrin (CHEBI:156408) has role fungal metabolite (CHEBI:76946) |
| monascorubrin (CHEBI:156408) has role Hsp90 inhibitor (CHEBI:63962) |
| monascorubrin (CHEBI:156408) is a azaphilone (CHEBI:50941) |
| monascorubrin (CHEBI:156408) is a enone (CHEBI:51689) |
| monascorubrin (CHEBI:156408) is a polyketide (CHEBI:26188) |
| monascorubrin (CHEBI:156408) is a triketone (CHEBI:140322) |
| monascorubrin (CHEBI:156408) is a γ-lactone (CHEBI:37581) |
| IUPAC Name |
|---|
| (9aR)-9a-methyl-3-octanoyl-6-[(1E)-prop-1-en-1-yl]-2H-furo[3,2-g]isochromene-2,9(9aH)-dione |
| Synonyms | Source |
|---|---|
| (9aR)-9a-methyl-3-octanoyl-6-[(1E)-prop-1-en-1-yl]-2H-furo[3,2-g][2]benzopyran-2,9(9aH)-dione | IUPAC |
| monasred | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP0469704 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:13283-90-4 | ChemIDplus |
| Citations |
|---|