EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156389 - 5-isoprenylindole-3-carboxylate β-D-glycosyl ester
| Formula | C20H21NO7 |
| Net Charge | 0 |
| Average Mass | 387.388 |
| Monoisotopic Mass | 387.13180 |
| SMILES | CC(C)=CCc1ccc2c(C(=O)O[C@@H]3OC(C(=O)O)=C[C@H](O)[C@H]3O)cnc2c1 |
| InChI | InChI=1S/C20H21NO7/c1-10(2)3-4-11-5-6-12-13(9-21-14(12)7-11)19(26)28-20-17(23)15(22)8-16(27-20)18(24)25/h3,5-9,15,17,20-23H,4H2,1-2H3,(H,24,25)/t15-,17+,20-/m0/s1 |
| InChIKey | ABLCZPDNHVQCBP-VPWXQRGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. RM-5-8 (ncbitaxon:1429103) | - | PubMed (28166207) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) has functional parent 1H-indole (CHEBI:16881) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) has functional parent 4-deoxy-Δ4-β-D-GlcpA (CHEBI:41893) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) has role bacterial metabolite (CHEBI:76969) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) is a carboxylic ester (CHEBI:33308) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) is a hexuronic acid (CHEBI:24592) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) is a indoles (CHEBI:24828) |
| 5-isoprenylindole-3-carboxylate β-D-glycosyl ester (CHEBI:156389) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (2S,3R,4S)-3,4-dihydroxy-2-((6-(3-methylbut-2-en-1-yl)-1H-indole-3-carbonyl)oxy)-3,4-dihydro-2H-pyran-6-carboxylic acid |
| Citations |
|---|