EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26N6O8 |
| Net Charge | 0 |
| Average Mass | 418.407 |
| Monoisotopic Mass | 418.18121 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@H](CC(=O)O)NC(=O)[C@@H](N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H26N6O8/c16-7(3-4-10(22)23)12(26)21-9(6-11(24)25)13(27)20-8(14(28)29)2-1-5-19-15(17)18/h7-9H,1-6,16H2,(H,20,27)(H,21,26)(H,22,23)(H,24,25)(H,28,29)(H4,17,18,19)/t7-,8-,9-/m0/s1 |
| InChIKey | QPRZKNOOOBWXSU-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Asp-Arg (CHEBI:156374) has functional parent L-arginine (CHEBI:16467) |
| Glu-Asp-Arg (CHEBI:156374) has functional parent L-aspartic acid (CHEBI:17053) |
| Glu-Asp-Arg (CHEBI:156374) has functional parent L-glutamic acid (CHEBI:16015) |
| Glu-Asp-Arg (CHEBI:156374) has role neuroprotective agent (CHEBI:63726) |
| Glu-Asp-Arg (CHEBI:156374) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-α-glutamyl-L-α-aspartyl-L-arginine |
| Synonyms | Source |
|---|---|
| E-D-R | ChEBI |
| EDR | ChEBI |
| H-Glu-Asp-Arg-OH | ChEBI |
| L-Glu-L-Asp-L-Arg | ChEBI |
| pinealon | ChEBI |
| Citations |
|---|