EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H27N3O3 |
| Net Charge | 0 |
| Average Mass | 273.377 |
| Monoisotopic Mass | 273.20524 |
| SMILES | CCCCCCCC(=O)NCC(C(C)C)N(O)N=O |
| InChI | InChI=1S/C13H27N3O3/c1-4-5-6-7-8-9-13(17)14-10-12(11(2)3)16(19)15-18/h11-12,19H,4-10H2,1-3H3,(H,14,17) |
| InChIKey | LOAGCJGEULMKRJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia cenocepacia (ncbitaxon:95486) | - | PubMed (29602945) | Strain: H111 |
| Roles Classification |
|---|
| Biological Role: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fragin (CHEBI:156354) has role antifungal agent (CHEBI:35718) |
| fragin (CHEBI:156354) is a secondary carboxamide (CHEBI:140325) |
| fragin (CHEBI:156354) is tautomer of fragin zwitterion (CHEBI:156352) |
| Incoming Relation(s) |
| fragin zwitterion (CHEBI:156352) is tautomer of fragin (CHEBI:156354) |
| Registry Numbers | Sources |
|---|---|
| CAS:17073-33-5 | ChemIDplus |
| Citations |
|---|