EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H27N3O3 |
| Net Charge | 0 |
| Average Mass | 273.377 |
| Monoisotopic Mass | 273.20524 |
| SMILES | CCCCCCCC(=O)NCC(C(C)C)/[N+]([O-])=N/O |
| InChI | InChI=1S/C13H27N3O3/c1-4-5-6-7-8-9-13(17)14-10-12(11(2)3)16(19)15-18/h11-12,18H,4-10H2,1-3H3,(H,14,17)/b16-15- |
| InChIKey | SXMAXSCAVUEAAA-NXVVXOECSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia cenocepacia (ncbitaxon:95486) | - | PubMed (29602945) | Strain: H111 |
| Roles Classification |
|---|
| Chemical Role: | |
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fragin zwitterion (CHEBI:156352) has role antibacterial agent (CHEBI:33282) |
| fragin zwitterion (CHEBI:156352) has role antifungal agent (CHEBI:35718) |
| fragin zwitterion (CHEBI:156352) has role iron chelator (CHEBI:38157) |
| fragin zwitterion (CHEBI:156352) is a azoxy compound (CHEBI:37390) |
| fragin zwitterion (CHEBI:156352) is a zwitterion (CHEBI:27369) |
| fragin zwitterion (CHEBI:156352) is tautomer of fragin (CHEBI:156354) |
| Incoming Relation(s) |
| fragin (CHEBI:156354) is tautomer of fragin zwitterion (CHEBI:156352) |
| Citations |
|---|