EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44N4O5 |
| Net Charge | 0 |
| Average Mass | 504.672 |
| Monoisotopic Mass | 504.33117 |
| SMILES | [H]C1=C(\[H])[C@]([H])(C)/N=C(/O)[C@@]([H])(/N=C(\O)[C@@]([H])(/N=C(O)/C([H])=C([H])/C([H])=C(\[H])CCCCCCC)[C@@]([H])(C)O)CCCC/N=C\1O |
| InChI | InChI=1S/C27H44N4O5/c1-4-5-6-7-8-9-10-11-12-16-24(34)31-25(21(3)32)27(36)30-22-15-13-14-19-28-23(33)18-17-20(2)29-26(22)35/h10-12,16-18,20-22,25,32H,4-9,13-15,19H2,1-3H3,(H,28,33)(H,29,35)(H,30,36)(H,31,34)/b11-10+,16-12+,18-17-/t20-,21+,22-,25-/m0/s1 |
| InChIKey | CXVPCSSIDACGGV-KNTXCBEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Photorhabdus asymbiotica subsp. asymbiotica ATCC 43949 (ncbitaxon:553480) | - | PubMed (23095088) | |
| Photorhabdus laumondii subsp. laumondii TTO1 (ncbitaxon:243265) | - | PubMed (22909174) | |
| unclassified Burkholderia (ncbitaxon:2613784) | - | PubMed (25147087) | Strain: DSM7029 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| Application: | proteasome inhibitor A drug that blocks the action of proteasomes, cellular complexes that break down proteins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luminmycin A (CHEBI:156322) has functional parent syrbactin (CHEBI:82671) |
| luminmycin A (CHEBI:156322) has role bacterial metabolite (CHEBI:76969) |
| luminmycin A (CHEBI:156322) has role proteasome inhibitor (CHEBI:52726) |
| luminmycin A (CHEBI:156322) is a azamacrocycle (CHEBI:52898) |
| luminmycin A (CHEBI:156322) is a homodetic cyclic peptide (CHEBI:24613) |
| luminmycin A (CHEBI:156322) is a lactam (CHEBI:24995) |
| luminmycin A (CHEBI:156322) is a pentol (CHEBI:37205) |
| luminmycin A (CHEBI:156322) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (2E,4E)-N-[(2S,3R)-3-Hydroxy-1-{[(3E,5S,8S)-5-methyl-2,7-dioxo-1,6-diazacyclododec-3-en-8-yl]amino}-1-oxo-2-butanyl]-2,4-dodecadienamide |
| Citations |
|---|