EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15N3O3 |
| Net Charge | 0 |
| Average Mass | 369.380 |
| Monoisotopic Mass | 369.11134 |
| SMILES | COC(=O)C1NC(=O)c2c1c1c3ccccc3nc1c1nc3ccccc3c21 |
| InChI | InChI=1S/C22H15N3O3/c1-28-22(27)20-16-14-10-6-2-4-8-12(10)23-18(14)19-15(17(16)21(26)25-20)11-7-3-5-9-13(11)24-19/h2-9,20,23-24H,1H3,(H,25,26) |
| InChIKey | DOZODIABNANYHJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erdasporine C (CHEBI:156315) has functional parent erdasporine B (CHEBI:156314) |
| erdasporine C (CHEBI:156315) has role antibacterial agent (CHEBI:33282) |
| erdasporine C (CHEBI:156315) has role antineoplastic agent (CHEBI:35610) |
| erdasporine C (CHEBI:156315) has role toxin (CHEBI:27026) |
| erdasporine C (CHEBI:156315) is a indolocarbazole alkaloid (CHEBI:37697) |
| erdasporine C (CHEBI:156315) is a methyl ester (CHEBI:25248) |
| erdasporine C (CHEBI:156315) is a organic heterohexacyclic compound (CHEBI:51914) |
| erdasporine C (CHEBI:156315) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| methyl 7-oxo-6,7,12,13-tetrahydro-5H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5-carboxylate |
| Synonym | Source |
|---|---|
| methyl 14-oxo-3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,4,6,8,10,15,17,19,21-nonaene-12-carboxylate | IUPAC |
| Citations |
|---|