EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H15N3O2 |
| Net Charge | 0 |
| Average Mass | 353.381 |
| Monoisotopic Mass | 353.11643 |
| SMILES | COC(=O)c1ncc2c1c1c3ccccc3nc1c1nc3ccccc3c21 |
| InChI | InChI=1S/C22H15N3O2/c1-27-22(26)21-18-13(10-23-21)16-11-6-2-4-8-14(11)24-19(16)20-17(18)12-7-3-5-9-15(12)25-20/h2-10,23-25H,1H3 |
| InChIKey | POAWNROCPSHGIZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| erdasporine B (CHEBI:156314) has role antibacterial agent (CHEBI:33282) |
| erdasporine B (CHEBI:156314) has role antineoplastic agent (CHEBI:35610) |
| erdasporine B (CHEBI:156314) has role toxin (CHEBI:27026) |
| erdasporine B (CHEBI:156314) is a indolocarbazole alkaloid (CHEBI:37697) |
| erdasporine B (CHEBI:156314) is a methyl ester (CHEBI:25248) |
| erdasporine B (CHEBI:156314) is a organic heterohexacyclic compound (CHEBI:51914) |
| erdasporine B (CHEBI:156314) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| erdasporine C (CHEBI:156315) has functional parent erdasporine B (CHEBI:156314) |
| IUPAC Name |
|---|
| methyl 12,13-dihydro-6H-indolo[2,3-a]pyrrolo[3,4-c]carbazole-5-carboxylate |
| Synonym | Source |
|---|---|
| methyl 3,13,23-triazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1(16),2(10),4,6,8,11,14,17,19,21-decaene-12-carboxylate | IUPAC |
| Citations |
|---|