EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H38N8O7S2 |
| Net Charge | 0 |
| Average Mass | 770.894 |
| Monoisotopic Mass | 770.23049 |
| SMILES | C[C@H]1CCC(C2=C(CC(=O)NCC(=O)c3csc(C(=O)C(=O)c4csc(CNC(=O)CC5=C(C6=N[C@@H](C)CC6)C(=O)NC56CC6)n4)n3)C3(CC3)NC2=O)=N1 |
| InChI | InChI=1S/C37H38N8O7S2/c1-17-3-5-21(40-17)29-19(36(7-8-36)44-33(29)51)11-26(47)38-13-25(46)23-15-54-35(43-23)32(50)31(49)24-16-53-28(42-24)14-39-27(48)12-20-30(22-6-4-18(2)41-22)34(52)45-37(20)9-10-37/h15-18H,3-14H2,1-2H3,(H,38,47)(H,39,48)(H,44,51)(H,45,52)/t17-,18-/m0/s1 |
| InChIKey | ZWKHDAZPVITMAI-ROUUACIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (29642622) | |
| Klebsiella pneumoniae (ncbitaxon:573) | - | PubMed (28409125) | Strain: K1 CC23 |
| Roles Classification |
|---|
| Biological Roles: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colibactin (CHEBI:156303) has role Escherichia coli metabolite (CHEBI:76971) |
| colibactin (CHEBI:156303) has role alkylating agent (CHEBI:22333) |
| colibactin (CHEBI:156303) has role carcinogenic agent (CHEBI:50903) |
| colibactin (CHEBI:156303) has role genotoxin (CHEBI:50902) |
| colibactin (CHEBI:156303) is a 1,3-thiazoles (CHEBI:38418) |
| colibactin (CHEBI:156303) is a azaspiro compound (CHEBI:35624) |
| colibactin (CHEBI:156303) is a polyketide (CHEBI:26188) |
| colibactin (CHEBI:156303) is a pyrroline (CHEBI:23763) |
| colibactin (CHEBI:156303) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| 2-{6-[(2S)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl}-N-({4-[{4-[(2-{6-[(2S)-2-methyl-3,4-dihydro-2H-pyrrol-5-yl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl}acetamido)acetyl]-1,3-thiazol-2-yl}(oxo)acetyl]-1,3-thiazol-2-yl}methyl)acetamide |
| Manual Xrefs | Databases |
|---|---|
| CPD-22719 | MetaCyc |
| Citations |
|---|