EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14N2O3 |
| Net Charge | 0 |
| Average Mass | 234.255 |
| Monoisotopic Mass | 234.10044 |
| SMILES | [H][C@@]12CCCN1C(=O)c1cccc(O)c1NC2O |
| InChI | InChI=1S/C12H14N2O3/c15-9-5-1-3-7-10(9)13-11(16)8-4-2-6-14(8)12(7)17/h1,3,5,8,11,13,15-16H,2,4,6H2/t8-,11?/m0/s1 |
| InChIKey | QEILHZZUMSPTRX-YMNIQAILSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Klebsiella oxytoca (ncbitaxon:571) | - | PubMed (32485104) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. toxin Poisonous substance produced by a biological organism such as a microbe, animal or plant. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tilimycin (CHEBI:156293) has role alkylating agent (CHEBI:22333) |
| tilimycin (CHEBI:156293) has role apoptosis inducer (CHEBI:68495) |
| tilimycin (CHEBI:156293) has role bacterial metabolite (CHEBI:76969) |
| tilimycin (CHEBI:156293) has role toxin (CHEBI:27026) |
| tilimycin (CHEBI:156293) is a phenols (CHEBI:33853) |
| tilimycin (CHEBI:156293) is a pyrrolobenzodiazepine (CHEBI:131437) |
| IUPAC Name |
|---|
| (11aS)-9,11-dihydroxy-1,2,3,10,11,11a-hexahydro-5H-pyrrolo[2,1-c][1,4]benzodiazepin-5-one |
| Citations |
|---|