EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18O11 |
| Net Charge | 0 |
| Average Mass | 458.375 |
| Monoisotopic Mass | 458.08491 |
| SMILES | O=C(O[C@@H]1Cc2c(O)cc(O)cc2O[C@H]1c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m1/s1 |
| InChIKey | WMBWREPUVVBILR-NQIIRXRSSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Camellia sinensis (ncbitaxon:4442) | - | DOI (10.1002/jsfa.2740220913) | |
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (10929811) | Identified after tea ingestion. |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor An EC 3.4.22.* (cysteine endopeptidase) inhibitor that interferes with the action of SARS coronavirus main proteinase (EC 3.4.22.69). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (−)-gallocatechin gallate (CHEBI:156271) has functional parent (−)-gallocatechin (CHEBI:71225) |
| (−)-gallocatechin gallate (CHEBI:156271) has functional parent gallic acid (CHEBI:30778) |
| (−)-gallocatechin gallate (CHEBI:156271) has role antineoplastic agent (CHEBI:35610) |
| (−)-gallocatechin gallate (CHEBI:156271) has role EC 3.4.22.69 (SARS coronavirus main proteinase) inhibitor (CHEBI:147285) |
| (−)-gallocatechin gallate (CHEBI:156271) has role human xenobiotic metabolite (CHEBI:76967) |
| (−)-gallocatechin gallate (CHEBI:156271) has role plant metabolite (CHEBI:76924) |
| (−)-gallocatechin gallate (CHEBI:156271) is a catechin (CHEBI:23053) |
| (−)-gallocatechin gallate (CHEBI:156271) is a gallate ester (CHEBI:37576) |
| (−)-gallocatechin gallate (CHEBI:156271) is a polyphenol (CHEBI:26195) |
| (−)-gallocatechin gallate (CHEBI:156271) is enantiomer of (+)-gallocatechin gallate (CHEBI:156284) |
| Incoming Relation(s) |
| (+)-gallocatechin gallate (CHEBI:156284) is enantiomer of (−)-gallocatechin gallate (CHEBI:156271) |
| IUPAC Name |
|---|
| (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-chromen-3-yl 3,4,5-trihydroxybenzoate |
| Synonyms | Source |
|---|---|
| (2S,3R)-2-(3,4,5-Trihydroxyphenyl)-3,4-dihydro-1(2H)-benzopyran-3,5,7-triol 3-(3,4,5-trihydroxybenzoate) | ChEBI |
| (2S,3R)-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3-yl 3,4,5-trihydroxybenzoate | IUPAC |
| (−)-gallocatechin-3-O-gallate | ChEBI |
| (−)-gallocatechol gallate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Gallocatechin_gallate | Wikipedia |
| LSM-6228 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:4233-96-9 | ChemIDplus |
| Citations |
|---|