EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14NO2Se |
| Net Charge | +1 |
| Average Mass | 211.143 |
| Monoisotopic Mass | 212.01843 |
| SMILES | C[Se+](C)CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2Se/c1-10(2)4-3-5(7)6(8)9/h5H,3-4,7H2,1-2H3/p+1/t5-/m1/s1 |
| InChIKey | QALHNGMTIIHGNI-RXMQYKEDSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Se-methyl-D-selenomethionine (CHEBI:156247) is a Se-methylselenomethionine (CHEBI:156246) |
| Se-methyl-D-selenomethionine (CHEBI:156247) is a D-α-amino acid (CHEBI:16733) |
| Se-methyl-D-selenomethionine (CHEBI:156247) is enantiomer of Se-methyl-L-selenomethionine (CHEBI:28513) |
| Incoming Relation(s) |
| Se-methyl-DL-selenomethionine (CHEBI:156242) has part Se-methyl-D-selenomethionine (CHEBI:156247) |
| Se-methyl-L-selenomethionine (CHEBI:28513) is enantiomer of Se-methyl-D-selenomethionine (CHEBI:156247) |
| IUPAC Name |
|---|
| [(3R)-3-amino-3-carboxypropyl](dimethyl)selenonium |
| Synonyms | Source |
|---|---|
| [(3R)-3-amino-3-carboxypropyl](dimethyl)selanium | IUPAC |
| D-Se-methylselenomethionin | ChEBI |