EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:156209 - S-ethyl-L-cysteine
| Formula | C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 149.215 |
| Monoisotopic Mass | 149.05105 |
| SMILES | CCSC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11NO2S/c1-2-9-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | ULXKXLZEOGLCRJ-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-ethyl-L-cysteine (CHEBI:156209) has role antitubercular agent (CHEBI:33231) |
| S-ethyl-L-cysteine (CHEBI:156209) is a S-alkyl-L-cysteine (CHEBI:47915) |
| S-ethyl-L-cysteine (CHEBI:156209) is tautomer of S-ethyl-L-cysteine zwitterion (CHEBI:156145) |
| Incoming Relation(s) |
| S-ethyl-L-cysteine zwitterion (CHEBI:156145) is tautomer of S-ethyl-L-cysteine (CHEBI:156209) |
| IUPAC Name |
|---|
| S-ethyl-L-cysteine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-(ethylsulfanyl)propanoic acid | IUPAC |
| (2R)-2-azanyl-3-ethylsulfanyl-propanoic acid | PDBeChem |
| 3-(ethylthio)alanine | ChEBI |
| 3-ethylthio-L-alanine | ChEBI |
| S-ethyl cysteine | ChEBI |
| S-ethylcysteine | ChEBI |
| Citations |
|---|