EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 149.215 |
| Monoisotopic Mass | 149.05105 |
| SMILES | CCSC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2S/c1-2-9-3-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | ULXKXLZEOGLCRJ-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-ethyl-L-cysteine zwitterion (CHEBI:156145) is a S-alkyl-L-cysteine zwitterion (CHEBI:82710) |
| S-ethyl-L-cysteine zwitterion (CHEBI:156145) is tautomer of S-ethyl-L-cysteine (CHEBI:156209) |
| Incoming Relation(s) |
| S-ethyl-L-cysteine (CHEBI:156209) is tautomer of S-ethyl-L-cysteine zwitterion (CHEBI:156145) |
| IUPAC Name |
|---|
| (2R)-2-azaniumyl-3-(ethylsulfanyl)propanoate |
| Synonyms | Source |
|---|---|
| 3-(ethylthio)alanine zwitterion | ChEBI |
| 3-ethylthio-L-alanine zwitterion | ChEBI |
| S-ethyl cysteine zwitterion | ChEBI |
| S-ethylcysteine zwitterion | ChEBI |
| UniProt Name | Source |
|---|---|
| S-ethyl-L-cysteine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-9300 | MetaCyc |
| Citations |
|---|