EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O6 |
| Net Charge | 0 |
| Average Mass | 500.676 |
| Monoisotopic Mass | 500.31379 |
| SMILES | [H][C@@]12CCC3=C(C(=O)C[C@]4(C)[C@@]([H])([C@H](C)C[C@H](O)/C=C(\C)C(=O)O)C[C@H](O)[C@@]34C)[C@@]1(C)CCC(=O)C2(C)C |
| InChI | InChI=1S/C30H44O6/c1-16(12-18(31)13-17(2)26(35)36)20-14-24(34)30(7)19-8-9-22-27(3,4)23(33)10-11-28(22,5)25(19)21(32)15-29(20,30)6/h13,16,18,20,22,24,31,34H,8-12,14-15H2,1-7H3,(H,35,36)/b17-13+/t16-,18+,20-,22+,24+,28+,29-,30-/m1/s1 |
| InChIKey | AUAXRALNWSHMRJ-YCEDVEOHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ganoderma lucidum (ncbitaxon:5315) | spore (BTO:0001171) | PubMed (10923835) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ganolucidic acid D (CHEBI:156195) has parent hydride lanostane (CHEBI:20265) |
| ganolucidic acid D (CHEBI:156195) has role fungal metabolite (CHEBI:76946) |
| ganolucidic acid D (CHEBI:156195) is a 11-oxo steroid (CHEBI:47787) |
| ganolucidic acid D (CHEBI:156195) is a 15α-hydroxy steroid (CHEBI:83147) |
| ganolucidic acid D (CHEBI:156195) is a 23-hydroxy steroid (CHEBI:36866) |
| ganolucidic acid D (CHEBI:156195) is a 3-oxo-5α-steroid (CHEBI:13601) |
| ganolucidic acid D (CHEBI:156195) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| ganolucidic acid D (CHEBI:156195) is a steroid acid (CHEBI:47891) |
| ganolucidic acid D (CHEBI:156195) is a tetracyclic triterpenoid (CHEBI:26893) |
| ganolucidic acid D (CHEBI:156195) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (23S,24E)-15α,23-dihydroxy-3,11-dioxolanosta-8,24-dien-26-oic acid |
| Synonyms | Source |
|---|---|
| (15α,23S,24E)-15,23-dihydroxy-3,11-dioxolanosta-8,24-dien-26-oic acid | ChemIDplus |
| (2E,4S,6R)-4-hydroxy-6-[(1R,3S,3aR,5aR,9aS,11aR)-3-hydroxy-3a,6,6,9a,11a-pentamethyl-7,10-dioxo-2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-methylhept-2-enoic acid | ChEBI |
| (+)-ganolucidic acid D | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00023873 | KNApSAcK |
| FDB013966 | FooDB |
| HMDB0035299 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:102607-22-7 | ChemIDplus |
| Citations |
|---|