EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O |
| Net Charge | 0 |
| Average Mass | 184.238 |
| Monoisotopic Mass | 184.08882 |
| SMILES | OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
| InChIKey | QILSFLSDHQAZET-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (604421) | |
| Pseudomonas putida (ncbitaxon:303) | - | PubMed (16345181) | |
| Rattus norvegicus (ncbitaxon:10116) | urine (BTO:0001419) | PubMed (461994) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. rat metabolite Any mammalian metabolite produced during a metabolic reaction in rat (Rattus norvegicus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphenylmethanol (CHEBI:156087) has parent hydride diphenylmethane (CHEBI:38884) |
| diphenylmethanol (CHEBI:156087) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| diphenylmethanol (CHEBI:156087) has role human urinary metabolite (CHEBI:84087) |
| diphenylmethanol (CHEBI:156087) has role human xenobiotic metabolite (CHEBI:76967) |
| diphenylmethanol (CHEBI:156087) has role rat metabolite (CHEBI:86264) |
| diphenylmethanol (CHEBI:156087) is a benzyl alcohols (CHEBI:22743) |
| diphenylmethanol (CHEBI:156087) is a secondary alcohol (CHEBI:35681) |
| Incoming Relation(s) |
| 4,4'-dichlorobenzhydrol (CHEBI:190399) has functional parent diphenylmethanol (CHEBI:156087) |
| IUPAC Name |
|---|
| diphenylmethanol |
| Synonyms | Source |
|---|---|
| benzhydrol | ChemIDplus |
| benzhydryl alcohol | ChemIDplus |
| benzohydrol | ChemIDplus |
| diphenyl carbinol | ChemIDplus |
| diphenylcarbinol | ChemIDplus |
| diphenylmethyl alcohol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| diphenylmethanol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Diphenylmethanol | Wikipedia |
| Citations |
|---|