EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H14O5 |
| Net Charge | 0 |
| Average Mass | 310.305 |
| Monoisotopic Mass | 310.08412 |
| SMILES | O=C1O[C@@](Cc2ccccc2)(C(=O)O)O/C1=C\c1ccccc1 |
| InChI | InChI=1S/C18H14O5/c19-16-15(11-13-7-3-1-4-8-13)22-18(23-16,17(20)21)12-14-9-5-2-6-10-14/h1-11H,12H2,(H,20,21)/b15-11-/t18-/m0/s1 |
| InChIKey | OLOMGTHWMBYIQH-RXBGNRNISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Guignardia bidwellii (ncbitaxon:115983) | - | PubMed (22779915) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenguignardic acid (CHEBI:155895) has role fungal metabolite (CHEBI:76946) |
| phenguignardic acid (CHEBI:155895) is a benzenes (CHEBI:22712) |
| phenguignardic acid (CHEBI:155895) is a dioxolane (CHEBI:39430) |
| phenguignardic acid (CHEBI:155895) is a monocarboxylic acid (CHEBI:25384) |
| phenguignardic acid (CHEBI:155895) is conjugate acid of phenguignardate (CHEBI:149629) |
| Incoming Relation(s) |
| phenguignardate (CHEBI:149629) is conjugate base of phenguignardic acid (CHEBI:155895) |
| IUPAC Name |
|---|
| (2S,4Z)-2-benzyl-4-benzylidene-5-oxo-1,3-dioxolane-2-carboxylic acid |
| Synonym | Source |
|---|---|
| (+)-phenguignardic acid | ChEBI |
| Citations |
|---|