EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H13O5 |
| Net Charge | -1 |
| Average Mass | 309.297 |
| Monoisotopic Mass | 309.07685 |
| SMILES | O=C1O[C@@](Cc2ccccc2)(C(=O)[O-])O/C1=C\c1ccccc1 |
| InChI | InChI=1S/C18H14O5/c19-16-15(11-13-7-3-1-4-8-13)22-18(23-16,17(20)21)12-14-9-5-2-6-10-14/h1-11H,12H2,(H,20,21)/p-1/b15-11-/t18-/m0/s1 |
| InChIKey | OLOMGTHWMBYIQH-RXBGNRNISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenguignardate (CHEBI:149629) is a monocarboxylic acid anion (CHEBI:35757) |
| phenguignardate (CHEBI:149629) is conjugate base of phenguignardic acid (CHEBI:155895) |
| Incoming Relation(s) |
| phenguignardic acid (CHEBI:155895) is conjugate acid of phenguignardate (CHEBI:149629) |
| IUPAC Name |
|---|
| (2S,4Z)-2-benzyl-4-benzylidene-5-oxo-1,3-dioxolane-2-carboxylate |
| Synonyms | Source |
|---|---|
| (+)-phenguignardate | ChEBI |
| phenguignardic acid(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| phenguignardate | UniProt |
| Citations |
|---|