EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H50N9O18P3S2 |
| Net Charge | 0 |
| Average Mass | 993.842 |
| Monoisotopic Mass | 993.19281 |
| SMILES | [H][C@]12CS[C@@H](CCCCC(=O)SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](O)[C@@H]3OP(=O)(O)O)[C@@]1([H])NC(=O)N2 |
| InChI | InChI=1S/C31H50N9O18P3S2/c1-31(2,25(44)28(45)34-8-7-19(41)33-9-10-62-20(42)6-4-3-5-18-21-16(12-63-18)38-30(46)39-21)13-55-61(52,53)58-60(50,51)54-11-17-24(57-59(47,48)49)23(43)29(56-17)40-15-37-22-26(32)35-14-36-27(22)40/h14-18,21,23-25,29,43-44H,3-13H2,1-2H3,(H,33,41)(H,34,45)(H,50,51)(H,52,53)(H2,32,35,36)(H2,38,39,46)(H2,47,48,49)/t16-,17+,18-,21-,23+,24+,25-,29+/m0/s1 |
| InChIKey | WNMONPKUDXWVKE-AJQVAGRLSA-N |
| Roles Classification |
|---|
| Chemical Role: | acyl donor Any donor that can transfer acyl groups between molecular entities. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| biotinyl-CoA (CHEBI:15516) has functional parent biotin (CHEBI:15956) |
| biotinyl-CoA (CHEBI:15516) is a acyl-CoA (CHEBI:17984) |
| biotinyl-CoA (CHEBI:15516) is conjugate acid of biotinyl-CoA(4−) (CHEBI:57370) |
| Incoming Relation(s) |
| biotinyl-CoA(4−) (CHEBI:57370) is conjugate base of biotinyl-CoA (CHEBI:15516) |
| IUPAC Name |
|---|
| S-{(9R)-1-[(2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-4-hydroxy-3-(phosphonooxy)oxolan-2-yl]-3,5,9-trihydroxy-8,8-dimethyl-3,5,10,14-tetraoxo-2,4,6-trioxa-11,15-diaza-3λ5,5λ5-diphosphaheptadecan-17-yl} 5-[(3aS,4S,6aR)-2-oxohexahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanethioate |
| Synonyms | Source |
|---|---|
| Biotinyl-CoA | KEGG COMPOUND |
| biotinyl-coenzyme A | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C01894 | KEGG COMPOUND |
| LMFA07050291 | LIPID MAPS |
| Citations |
|---|