EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H32MgN4O5 |
| Net Charge | 0 |
| Average Mass | 612.969 |
| Monoisotopic Mass | 612.22231 |
| SMILES | C=CC1=C(C)C2=[N]3C1=Cc1c(C)c(C(=O)CC(=O)OC)c4[n]1[Mg]31[N]3=C(C=c5c(C)c(C=C)c([n]51)=C2)C(C)=C(CCC(=O)O)C3=C4 |
| InChI | InChI=1S/C35H34N4O5.Mg/c1-8-21-17(3)24-12-25-19(5)23(10-11-33(41)42)30(38-25)15-31-35(32(40)16-34(43)44-7)20(6)27(39-31)14-29-22(9-2)18(4)26(37-29)13-28(21)36-24;/h8-9,12-15H,1-2,10-11,16H2,3-7H3,(H3,36,37,38,39,40,41,42);/q;+2/p-2/b24-12-,25-12-,26-13-,27-14-,28-13-,29-14-,30-15-,31-15-; |
| InChIKey | IOQIILLGNAOXJE-JXBSUKTBSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) has functional parent magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) is a dicarboxylic acid monoester (CHEBI:36244) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) is a magnesium porphyrin (CHEBI:25111) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) is a methyl ester (CHEBI:25248) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) is conjugate acid of magnesium 131-oxoprotoporphyrin 13-monomethyl ester(1−) (CHEBI:60490) |
| Incoming Relation(s) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester(1−) (CHEBI:60490) is conjugate base of magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) |
| IUPAC Name |
|---|
| {3-[18-(3-methoxy-3-oxopropanoyl)-3,7,12,17-tetramethyl-8,13-divinylporphyrin-2-yl-κ4N21,N22,N23,N24]propanoato(2−)}magnesium |
| Synonyms | Source |
|---|---|
| [7,12-diethenyl-18-(3-ethoxy-1,3-dioxopropyl)-3,8,13,17-tetramethylporphyrin-2-propanoato]magnesium(II) | JCBN |
| 13(1)-Oxo-magnesium-protoporphyrin IX 13-monomethyl ester | KEGG COMPOUND |
| 13(1)-Oxo-Mg-protoporphyrin IX 13-monomethyl ester | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C11830 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5715265 | Beilstein |