EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34MgN4O4 |
| Net Charge | 0 |
| Average Mass | 598.986 |
| Monoisotopic Mass | 598.24305 |
| SMILES | C=CC1=C(C)C2=Cc3c(C=C)c(C)c4[n]3[Mg]35[N]2=C1C=c1c(C)c(CCC(=O)OC)c([n]13)=CC1=[N]5C(=C4)C(C)=C1CCC(=O)O |
| InChI | InChI=1S/C35H35N4O4.Mg/c1-8-22-18(3)26-14-27-20(5)24(10-12-34(40)41)32(38-27)17-33-25(11-13-35(42)43-7)21(6)29(39-33)16-31-23(9-2)19(4)28(37-31)15-30(22)36-26;/h8-9,14-17H,1-2,10-13H2,3-7H3,(H2-,36,37,38,39,40,41);/q-1;+2/p-1/b26-14-,27-14-,28-15-,29-16-,30-15-,31-16-,32-17-,33-17-; |
| InChIKey | JHTBRMHXRULRGV-NCCDZXNNSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) has functional parent magnesium protoporphyrin (CHEBI:15431) |
| magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) is a dicarboxylic acid monoester (CHEBI:36244) |
| magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) is a magnesium porphyrin (CHEBI:25111) |
| magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) is a methyl ester (CHEBI:25248) |
| magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) is conjugate acid of magnesium protoporphyrin 13-monomethyl ester(1−) (CHEBI:60491) |
| Incoming Relation(s) |
| magnesium 131-hydroxyprotoporphyrin 13-monomethyl ester (CHEBI:15434) has functional parent magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) |
| magnesium 131-oxoprotoporphyrin 13-monomethyl ester (CHEBI:15433) has functional parent magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) |
| magnesium protoporphyrin 13-monomethyl ester(1−) (CHEBI:60491) is conjugate base of magnesium protoporphyrin 13-monomethyl ester (CHEBI:15432) |
| Synonyms | Source |
|---|---|
| [7,12-diethenyl-18-(3-methoxy-3-oxopropyl)-3,8,13,17-tetramethylporphyrin-2-propanoato]magnesium(II) | JCBN |
| Magnesium protoporphyrin IX 13-methyl ester | KEGG COMPOUND |
| Magnesium-protoporphyrin IX 13-monomethyl ester | KEGG COMPOUND |
| Magnesium protoporphyrin monomethyl ester | KEGG COMPOUND |
| Mg-Protoporphyrin IX 13-monomethyl ester | KEGG COMPOUND |