EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15ClO4 |
| Net Charge | 0 |
| Average Mass | 258.701 |
| Monoisotopic Mass | 258.06589 |
| SMILES | CCCCCC(=O)c1c(O)cc(O)c(Cl)c1O |
| InChI | InChI=1S/C12H15ClO4/c1-2-3-4-5-7(14)10-8(15)6-9(16)11(13)12(10)17/h6,15-17H,2-5H2,1H3 |
| InChIKey | OTRYFPNTAFPSBU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | eukaryotic metabolite Any metabolite produced during a metabolic reaction in eukaryotes, the taxon that include members of the fungi, plantae and animalia kingdoms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) has role eukaryotic metabolite (CHEBI:75763) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) is a aromatic ketone (CHEBI:76224) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) is a benzenetriol (CHEBI:22707) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) is a monochlorobenzenes (CHEBI:83403) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) is conjugate acid of (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:152555) |
| Incoming Relation(s) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:152555) is conjugate base of (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) |
| IUPAC Name |
|---|
| 1-(3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one |
| Synonyms | Source |
|---|---|
| 1-(2,4,6-trihydroxy-3-chlorophenyl)-1-hexanone | ChEBI |
| 1-(3-chloro-2,4,6-trihydroxyphenyl)-1-hexanone | ChEBI |
| chloro-THPH | ChEBI |
| Cl-THPH | ChEBI |
| Citations |
|---|