EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14ClO4 |
| Net Charge | -1 |
| Average Mass | 257.693 |
| Monoisotopic Mass | 257.05861 |
| SMILES | CCCCCC(=O)c1c(O)cc([O-])c(Cl)c1O |
| InChI | InChI=1S/C12H15ClO4/c1-2-3-4-5-7(14)10-8(15)6-9(16)11(13)12(10)17/h6,15-17H,2-5H2,1H3/p-1 |
| InChIKey | OTRYFPNTAFPSBU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:152555) is a phenolate anion (CHEBI:50525) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:152555) is conjugate base of (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) |
| Incoming Relation(s) |
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one (CHEBI:153569) is conjugate acid of (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one(1−) (CHEBI:152555) |
| IUPAC Name |
|---|
| 2-chloro-4-hexanoyl-3,5-dihydroxyphenolate |
| Synonyms | Source |
|---|---|
| Cl-THPH(1−) | ChEBI |
| chloro-THPH(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| (3-chloro-2,4,6-trihydroxyphenyl)hexan-1-one | UniProt |
| Citations |
|---|