EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N4O9P |
| Net Charge | 0 |
| Average Mass | 364.207 |
| Monoisotopic Mass | 364.04201 |
| SMILES | O=c1nc(=O)c2ncn([C@@H]3O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/t3-,5-,6-,9-/m1/s1 |
| InChIKey | DCTLYFZHFGENCW-UUOKFMHZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-xanthylic acid (CHEBI:15652) has role Escherichia coli metabolite (CHEBI:76971) |
| 5'-xanthylic acid (CHEBI:15652) has role metabolite (CHEBI:25212) |
| 5'-xanthylic acid (CHEBI:15652) has role mouse metabolite (CHEBI:75771) |
| 5'-xanthylic acid (CHEBI:15652) is a purine ribonucleoside 5'-monophosphate (CHEBI:37021) |
| 5'-xanthylic acid (CHEBI:15652) is a xanthosine 5'-phosphate (CHEBI:53012) |
| 5'-xanthylic acid (CHEBI:15652) is conjugate acid of 5'-xanthylate(2−) (CHEBI:57464) |
| Incoming Relation(s) |
| urate D-ribonucleotide (CHEBI:17145) has functional parent 5'-xanthylic acid (CHEBI:15652) |
| 5'-xanthylate(2−) (CHEBI:57464) is conjugate base of 5'-xanthylic acid (CHEBI:15652) |
| IUPAC Name |
|---|
| 5'-xanthylic acid |
| Synonyms | Source |
|---|---|
| (9-D-ribosylxanthine)-5'-phosphate | ChEBI |
| (9-D-Ribosylxanthine)-5'-phosphate | KEGG COMPOUND |
| Xanthosine 5'-phosphate | KEGG COMPOUND |
| xanthosine monophosphate | ChEBI |
| Xanthylic acid | KEGG COMPOUND |
| XMP | KEGG COMPOUND |
| Citations |
|---|