EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@@H]1O[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a121h-1b_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5-/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-QTBDOELSSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-L-xylofuranose (CHEBI:153151) is a L-xylofuranose (CHEBI:153065) |
| IUPAC Names |
|---|
| b-L-Xylf |
| β-L-xylofuranose |
| β-Xylf |
| Synonym | Source |
|---|---|
| β-L-xylo-pentofuranose | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| G71414OZ | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| CAS:41546-29-6 | ChemIDplus |