EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@@H]1OC(O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[o121h]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5?/m0/s1 |
| InChIKey | HMFHBZSHGGEWLO-CZBDKTQLSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-xylofuranose (CHEBI:153065) is a L-xylose (CHEBI:65328) |
| L-xylofuranose (CHEBI:153065) is enantiomer of D-xylofuranose (CHEBI:146758) |
| Incoming Relation(s) |
| α-L-xylofuranose (CHEBI:152825) is a L-xylofuranose (CHEBI:153065) |
| β-L-xylofuranose (CHEBI:153151) is a L-xylofuranose (CHEBI:153065) |
| D-xylofuranose (CHEBI:146758) is enantiomer of L-xylofuranose (CHEBI:153065) |
| IUPAC Names |
|---|
| LXylf |
| L-xylofuranose |
| Synonyms | Source |
|---|---|
| L-xylo-pentofuranose | IUPAC |
| L-Xylf | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| G38019KV | GlyTouCan |