EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H10O5 |
| Net Charge | 0 |
| Average Mass | 150.130 |
| Monoisotopic Mass | 150.05282 |
| SMILES | OC[C@H]1O[C@H](O)[C@H](O)[C@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a212h-1a_1-4]/1/ |
| InChI | InChI=1S/C5H10O5/c6-1-2-3(7)4(8)5(9)10-2/h2-9H,1H2/t2-,3+,4-,5+/m1/s1 |
| InChIKey | HMFHBZSHGGEWLO-LECHCGJUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-D-xylofuranose (CHEBI:152854) is a D-xylofuranose (CHEBI:146758) |
| α-D-xylofuranose (CHEBI:152854) is a pentose (CHEBI:25901) |
| α-D-xylofuranose (CHEBI:152854) is enantiomer of α-L-xylofuranose (CHEBI:152825) |
| Incoming Relation(s) |
| α-L-xylofuranose (CHEBI:152825) is enantiomer of α-D-xylofuranose (CHEBI:152854) |
| IUPAC Names |
|---|
| a-Xylf |
| α-D-xylofuranose |
| Synonym | Source |
|---|---|
| alpha-D-xylo-pentofuranose | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:14795-83-6 | ChemIDplus |