EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H18O10 |
| Net Charge | 0 |
| Average Mass | 538.464 |
| Monoisotopic Mass | 538.09000 |
| SMILES | Cc1cc2c(c(O)c1-c1c(C)cc(O)c3c1C(=O)c1ccc(O)c(O)c1C3=O)C(=O)c1c(ccc(O)c1O)C2=O |
| InChI | InChI=1S/C30H18O10/c1-9-7-13-21(29(39)19-11(24(13)34)3-5-14(31)26(19)36)28(38)18(9)17-10(2)8-16(33)22-23(17)25(35)12-4-6-15(32)27(37)20(12)30(22)40/h3-8,31-33,36-38H,1-2H3 |
| InChIKey | XHKQDFVQROFUEL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cladosporium fulvum (ncbitaxon:5499) | cell suspension culture (BTO:0000221) | PubMed (24465762) |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. biological pigment An endogenous molecular entity that results in a colour of an organism as the consequence of the selective absorption of light. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cladofulvin (CHEBI:152056) has functional parent nataloe-emodin (CHEBI:152054) |
| cladofulvin (CHEBI:152056) has role biological pigment (CHEBI:26130) |
| cladofulvin (CHEBI:152056) has role fungal metabolite (CHEBI:76946) |
| cladofulvin (CHEBI:152056) is a bianthracenes (CHEBI:145988) |
| cladofulvin (CHEBI:152056) is a polyphenol (CHEBI:26195) |
| cladofulvin (CHEBI:152056) is a trihydroxyanthraquinone (CHEBI:37488) |
| cladofulvin (CHEBI:152056) is conjugate acid of cladofulvin(2−) (CHEBI:152057) |
| Incoming Relation(s) |
| cladofulvin(2−) (CHEBI:152057) is conjugate base of cladofulvin (CHEBI:152056) |
| IUPAC Name |
|---|
| 1',4,5,6,7',8'-hexahydroxy-2,3'-dimethyl[1,2'-bianthracene]-9,9',10,10'-tetrone |
| Registry Numbers | Sources |
|---|---|
| CAS:11032-85-2 | ChEBI |
| Citations |
|---|