EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H10O5 |
| Net Charge | 0 |
| Average Mass | 270.240 |
| Monoisotopic Mass | 270.05282 |
| SMILES | Cc1cc(O)c2c(c1)C(=O)c1ccc(O)c(O)c1C2=O |
| InChI | InChI=1S/C15H10O5/c1-6-4-8-11(10(17)5-6)15(20)12-7(13(8)18)2-3-9(16)14(12)19/h2-5,16-17,19H,1H3 |
| InChIKey | WLOSKKPZIOUGFB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Picramnia latifolia (ncbitaxon:681474) | leaf (BTO:0000713) | PubMed (15043409) | |
| Picramnia sellowii (ncbitaxon:2686319) | leaf (BTO:0000713) | PubMed (18163590) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nataloe-emodin (CHEBI:152054) has role antibacterial agent (CHEBI:33282) |
| nataloe-emodin (CHEBI:152054) has role antineoplastic agent (CHEBI:35610) |
| nataloe-emodin (CHEBI:152054) has role plant metabolite (CHEBI:76924) |
| nataloe-emodin (CHEBI:152054) is a trihydroxyanthraquinone (CHEBI:37488) |
| nataloe-emodin (CHEBI:152054) is conjugate acid of nataloe-emodin(1−) (CHEBI:152055) |
| Incoming Relation(s) |
| cladofulvin (CHEBI:152056) has functional parent nataloe-emodin (CHEBI:152054) |
| nataloe-emodin(1−) (CHEBI:152055) is conjugate base of nataloe-emodin (CHEBI:152054) |
| IUPAC Name |
|---|
| 1,2,8-trihydroxy-6-methylanthracene-9,10-dione |
| Synonyms | Source |
|---|---|
| 1,2,8-trihydroxy-6-methyl-9,10-anthraquinone | ChEBI |
| 1,2,8-trihydroxy-6-methylanthra-9,10-quinone | SUBMITTER |
| 1,2,8-trihydroxy-6-methylanthraquinone | ChEBI |
| nataloe emodin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:478-46-6 | ChEBI |
| Citations |
|---|