EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O |
| Net Charge | 0 |
| Average Mass | 124.143 |
| Monoisotopic Mass | 124.06366 |
| SMILES | Nc1ccncc1CO |
| InChI | InChI=1S/C6H8N2O/c7-6-1-2-8-3-5(6)4-9/h1-3,9H,4H2,(H2,7,8) |
| InChIKey | WNBVEYMTVDMSFZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-aminopyridine-3-methanol (CHEBI:149772) has functional parent 4-aminopyridine (CHEBI:34385) |
| 4-aminopyridine-3-methanol (CHEBI:149772) has role potassium channel blocker (CHEBI:50509) |
| 4-aminopyridine-3-methanol (CHEBI:149772) is a aminopyridine (CHEBI:38207) |
| 4-aminopyridine-3-methanol (CHEBI:149772) is a aromatic amine (CHEBI:33860) |
| 4-aminopyridine-3-methanol (CHEBI:149772) is a aromatic primary alcohol (CHEBI:33857) |
| IUPAC Name |
|---|
| (4-aminopyridin-3-yl)methanol |
| Synonyms | Source |
|---|---|
| 4-amino-3-(hydroxymethyl)pyridine | ChEBI |
| 4-AP-3-MeOH | SUBMITTER |
| 4-amino-3-pyridinemethanol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:138116-34-4 | ChEBI |
| Citations |
|---|