EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34N4O4 |
| Net Charge | 0 |
| Average Mass | 562.670 |
| Monoisotopic Mass | 562.25801 |
| SMILES | C=CC1=C(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35,38H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | KSFOVUSSGSKXFI-UJJXFSCMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoporphyrin (CHEBI:15430) has role Escherichia coli metabolite (CHEBI:76971) |
| protoporphyrin (CHEBI:15430) has role metabolite (CHEBI:25212) |
| protoporphyrin (CHEBI:15430) has role mouse metabolite (CHEBI:75771) |
| protoporphyrin (CHEBI:15430) has role photosensitizing agent (CHEBI:47868) |
| protoporphyrin (CHEBI:15430) is a protoporphyrins (CHEBI:26361) |
| protoporphyrin (CHEBI:15430) is conjugate acid of protoporphyrin(2−) (CHEBI:57306) |
| protoporphyrin (CHEBI:15430) is conjugate acid of protoporphyrinate (CHEBI:36159) |
| Incoming Relation(s) |
| hematoporphyrin (CHEBI:36162) has functional parent protoporphyrin (CHEBI:15430) |
| protoporphyrin monomethyl ester (CHEBI:36160) has functional parent protoporphyrin (CHEBI:15430) |
| protoporphyrin(2−) (CHEBI:57306) is conjugate base of protoporphyrin (CHEBI:15430) |
| protoporphyrinate (CHEBI:36159) is conjugate base of protoporphyrin (CHEBI:15430) |
| IUPAC Name |
|---|
| 7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoic acid |
| Synonyms | Source |
|---|---|
| 3,3'-(3,7,12,17-tetramethyl-8,13-divinyl-21H,23H-porphine-2,18-diyl)-bis-propionic acid | HMDB |
| 3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-dipropanoic acid | IUPAC |
| H2ppIX | IUPAC |
| Kammerer's prophyrin | NIST Chemistry WebBook |
| ooporphyrin | ChemIDplus |
| Porphyrinogen IX | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3500 | DrugCentral |
| C00007370 | KNApSAcK |
| C02191 | KEGG COMPOUND |
| DB02285 | DrugBank |
| HMDB0000241 | HMDB |
| PP9 | PDBeChem |
| Protoporphyrin_IX | Wikipedia |
| PROTOPORPHYRIN_IX | MetaCyc |
| Citations |
|---|