EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34N4O4 |
| Net Charge | 0 |
| Average Mass | 562.670 |
| Monoisotopic Mass | 562.25801 |
| SMILES | C=CC1=C(C)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5CCC(=O)O)C(CCC(=O)O)=C4C)c(C)c3C=C |
| InChI | InChI=1S/C34H34N4O4/c1-7-21-17(3)25-13-26-19(5)23(9-11-33(39)40)31(37-26)16-32-24(10-12-34(41)42)20(6)28(38-32)15-30-22(8-2)18(4)27(36-30)14-29(21)35-25/h7-8,13-16,35,38H,1-2,9-12H2,3-6H3,(H,39,40)(H,41,42)/b25-13-,26-13-,27-14-,28-15-,29-14-,30-15-,31-16-,32-16- |
| InChIKey | KSFOVUSSGSKXFI-UJJXFSCMSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protoporphyrin (CHEBI:15430) has role Escherichia coli metabolite (CHEBI:76971) |
| protoporphyrin (CHEBI:15430) has role metabolite (CHEBI:25212) |
| protoporphyrin (CHEBI:15430) has role mouse metabolite (CHEBI:75771) |
| protoporphyrin (CHEBI:15430) has role photosensitizing agent (CHEBI:47868) |
| protoporphyrin (CHEBI:15430) is a protoporphyrins (CHEBI:26361) |
| protoporphyrin (CHEBI:15430) is conjugate acid of protoporphyrin(2−) (CHEBI:57306) |
| protoporphyrin (CHEBI:15430) is conjugate acid of protoporphyrinate (CHEBI:36159) |
| Incoming Relation(s) |
| hematoporphyrin (CHEBI:36162) has functional parent protoporphyrin (CHEBI:15430) |
| protoporphyrin monomethyl ester (CHEBI:36160) has functional parent protoporphyrin (CHEBI:15430) |
| protoporphyrin(2−) (CHEBI:57306) is conjugate base of protoporphyrin (CHEBI:15430) |
| protoporphyrinate (CHEBI:36159) is conjugate base of protoporphyrin (CHEBI:15430) |
| IUPAC Name |
|---|
| 7,12-diethenyl-3,8,13,17-tetramethylporphyrin-2,18-dipropanoic acid |
| Synonyms | Source |
|---|---|
| 3,3'-(3,7,12,17-tetramethyl-8,13-divinyl-21H,23H-porphine-2,18-diyl)-bis-propionic acid | HMDB |
| 3,7,12,17-tetramethyl-8,13-divinylporphyrin-2,18-dipropanoic acid | IUPAC |
| H2ppIX | IUPAC |
| Kammerer's prophyrin | NIST Chemistry WebBook |
| ooporphyrin | ChemIDplus |
| Porphyrinogen IX | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3500 | DrugCentral |
| C00007370 | KNApSAcK |
| C02191 | KEGG COMPOUND |
| DB02285 | DrugBank |
| HMDB0000241 | HMDB |
| PP9 | PDBeChem |
| Protoporphyrin_IX | Wikipedia |
| PROTOPORPHYRIN_IX | MetaCyc |
| Citations |
|---|