EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N4O6 |
| Net Charge | 0 |
| Average Mass | 598.700 |
| Monoisotopic Mass | 598.27913 |
| SMILES | CC1=C(CCC(=O)O)c2cc3nc(cc4nc(cc5nc(cc1n2)c(C)c5C(C)O)C(C)=C4C(C)O)c(C)c3CCC(=O)O |
| InChI | InChI=1S/C34H38N4O6/c1-15-21(7-9-31(41)42)27-14-28-22(8-10-32(43)44)16(2)24(36-28)12-29-34(20(6)40)18(4)26(38-29)13-30-33(19(5)39)17(3)25(37-30)11-23(15)35-27/h11-14,19-20,36-37,39-40H,7-10H2,1-6H3,(H,41,42)(H,43,44)/b23-11-,24-12-,25-11-,26-13-,27-14-,28-14-,29-12-,30-13- |
| InChIKey | UJKPHYRXOLRVJJ-AMPAVEGJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hematoporphyrin (CHEBI:36162) has functional parent protoporphyrin (CHEBI:15430) |
| hematoporphyrin (CHEBI:36162) has role photosensitizing agent (CHEBI:47868) |
| hematoporphyrin (CHEBI:36162) is a dicarboxylic acid (CHEBI:35692) |
| hematoporphyrin (CHEBI:36162) is a protoporphyrins (CHEBI:26361) |
| IUPAC Name |
|---|
| 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethylporphyrin-2,18-dipropanoic acid |
| Synonyms | Source |
|---|---|
| 7,12-bis(1-hydroxyethyl)-3,8,13,17-tetramethyl-21H,23H-porphine-2,18-dipropanoic acid | ChemIDplus |
| Hämatoporphyrin | ChEBI |
| hematoporphyrin | ChemIDplus |
| hematoporphyrin IX | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 3274 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1208096 | Reaxys |
| Gmelin:423149 | Gmelin |
| Beilstein:604648 | Beilstein |
| Reaxys:78957 | Reaxys |
| CAS:14459-29-1 | ChemIDplus |
| Citations |
|---|